864719-17-5
Chemical Structure
Sequosempervirin B
- CAS No.: 864719-17-5
- Formula:C18H20O5
- Molecular Weight:316.35
IUPAC Name: (2S,3S,E)-3-(4-hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)pent-4-ene-1,2-diol
InChIKey: JRWXFOFDIRHTQG-GRNKITJOSA-N
SMILES: OC[C@@H](O)[C@H](C1=CC=C(O)C(OC)=C1)/C=C/C2=CC=C(O)C=C2
Biological Activity: Sequosempervirin B, a norlignan isolated from the branches and leaves of Sequoia sempervirens, has antifungal properties. Sequosempervirin B has an inhibitory effect on cyclic AMP phosphodiesterase[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sequosempervirin B | Sequosempervirin B, a norlignan isolated from the branches and leaves of Sequoia sempervirens, has antifungal properties. Sequosempervirin B has an inhibitory effect on cyclic AMP phosphodiesterase. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||