864860-32-2
Chemical Structure
NPC26
- CAS. Nr.: 864860-32-2
- Formula:C19H23N3O5S2
- Molecular Weight:437.53
InChIKey: DWGSXNATVAGHKZ-UHFFFAOYSA-N
SMILES: O=C(C1=C(NC(C2=CC=C([N+]([O-])=O)S2)=O)SC3=C1CC(C)(C)NC3(C)C)OCC
Biological Activity: NPC26 is a small molecule mitochondrial disruptor with anti-tumor activity. NPC-26 shows significant anti-proliferative and cytotoxic effects on CRC cell lines (HCT-116, DLD-1, and HT-29). NPC26 can damage mitochondrial function, leading to the opening of the mitochondrial permeability transition pore (mPTP) and the production of reactive oxygen species, ultimately inducing cell death. NPC-26 can kill CRC cells by activating the AMP-activated protein kinase (AMPK) signaling pathway[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NPC26 | 98.0% | NPC26 is a small molecule mitochondrial disruptor with anti-tumor activity. NPC-26 shows significant anti-proliferative and cytotoxic effects on CRC cell lines (HCT-116, DLD-1, and HT-29). NPC26 can damage mitochondrial function, leading to the opening of the mitochondrial permeability transition pore (mPTP) and the production of reactive oxygen species, ultimately inducing cell death. NPC-26 can kill CRC cells by activating the AMP-activated protein kinase (AMPK) signaling pathway. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords