86615-96-5
Chemical Structure
BRL 35135
- CAS No.: 86615-96-5
- Formula:C20H24ClNO4
- Molecular Weight:377.86
IUPAC Name: methyl 2-(4-((S)-2-(((S)-2-(3-chlorophenyl)-2-hydroxyethyl)amino)propyl)phenoxy)acetate
InChIKey: ZFLBZHXQAMUEFS-IFXJQAMLSA-N
SMILES: COC(COC(C=C1)=CC=C1C[C@H](C)NC[C@H](C2=CC(Cl)=CC=C2)O)=O
Biological Activity: BRL 35135 is a potent and selective β3-adrenergic receptor agonist. BRL 35135 can dose dependently increase energy expenditure, reduce weight, and only reduce fat without reducing muscle protein. BRL 35135 can significantly improve glucose tolerance and insulin sensitivity. BRL 35135 can be used to study metabolic conditions such as obesity and diabetes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BRL 35135 | BRL 35135 is a potent and selective β3-adrenergic receptor agonist. BRL 35135 can dose dependently increase energy expenditure, reduce weight, and only reduce fat without reducing muscle protein. BRL 35135 can significantly improve glucose tolerance and insulin sensitivity. BRL 35135 can be used to study metabolic conditions such as obesity and diabetes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||