86770-69-6
Chemical Structure
Azido-PEG6-alcohol
- CAS No.: 86770-69-6
- Formula:C12H25N3O6
- Molecular Weight:307.34
IUPAC Name: 17-azido-3,6,9,12,15-pentaoxaheptadecan-1-ol
InChIKey: DPRULTZUGLDCPZ-UHFFFAOYSA-N
SMILES: OCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG6-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG6-alcohol is also a non-cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[2]. Azido-PEG6-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG6-alcohol | 98.0% | Azido-PEG6-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG6-alcohol is also a non-cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG6-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
