906007-10-1
Chemical Structure
Azide-PEG6-Tos
- CAS No.: 906007-10-1
- Formula:C19H31N3O8S
- Molecular Weight:461.53
IUPAC Name: 17-azido-3,6,9,12,15-pentaoxaheptadecyl 4-methylbenzenesulfonate
InChIKey: DZQISMWOKQMODJ-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOS(C1=CC=C(C)C=C1)(=O)=O
Biological Activity: Azide-PEG6-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG6-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-PEG6-Tos | 98.60% | Azide-PEG6-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG6-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||