948573-98-6
Chemical Structure
Kipukasin B
- CAS No.: 948573-98-6
- Formula:C20H22N2O10
- Molecular Weight:450.40
InChIKey: ULPUBSPPYRXUOZ-BNEJOLLZSA-N
SMILES: O=C(C=CN1[C@H]2[C@H](OC(C)=O)[C@H](OC(C3=C(OC)C=C(O)C=C3C)=O)[C@@H](CO)O2)NC1=O
Biological Activity: Kipukasin B is an antibacterial agent. Kipukasin B exhibits activity against the Gram-positive strain Bacillus subtilis. Kipukasin B is isolated from Aspergillus versicolor obtained from Hawaii. Kipukasin B can be used in the research of Gram-positive bacterial infections[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Kipukasin B | Kipukasin B is an antibacterial agent. Kipukasin B exhibits activity against the Gram-positive strain Bacillus subtilis. Kipukasin B is isolated from Aspergillus versicolor obtained from Hawaii. Kipukasin B can be used in the research of Gram-positive bacterial infections. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||