951671-92-4
Chemical Structure
N3-PEG4-C2-NH2
Synonym(s): PROTAC Linker 20
- CAS No.: 951671-92-4
- Formula:C10H22N4O4
- Molecular Weight:262.31
IUPAC Name: 14-azido-3,6,9,12-tetraoxatetradecan-1-amine
InChIKey: ZMBGKXBIVYXREN-UHFFFAOYSA-N
SMILES: NCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: N3-PEG4-C2-NH2 (PROTAC Linker 20) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. N3-PEG4-C2-NH2 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG4-C2-NH2 | 98.0% | N3-PEG4-C2-NH2 (PROTAC Linker 20) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. N3-PEG4-C2-NH2 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||