98179-10-3
Chemical Structure
Thymidine 5′-monophosphate p-nitrophenyl ester sodium
- CAS No.: 98179-10-3
- Formula:C16H17N3NaO10P
- Molecular Weight:465.28
IUPAC Name: sodium ((2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-2-yl)methyl (4-nitrophenyl) phosphate
InChIKey: SAOVUDQFCPCFIV-SOIKFHLCSA-M
SMILES: O=C(N1)N([C@@H]2O[C@H](COP(OC3=CC=C([N+]([O-])=O)C=C3)(O[Na])=O)[C@@H](O)C2)C=C(C)C1=O
Biological Activity: Thymidine 5′-monophosphate p-nitrophenyl ester sodium (Compound 2a) is the derivative of thymidine 5'-phosphate (TMP). Thymidine 5′-monophosphate p-nitrophenyl ester sodium is potential as an antitumor prodrug[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Thymidine 5′-monophosphate p-nitrophenyl ester sodium | 99.85% | Thymidine 5′-monophosphate p-nitrophenyl ester sodium (Compound 2a) is the derivative of thymidine 5'-phosphate (TMP). Thymidine 5′-monophosphate p-nitrophenyl ester sodium is potential as an antitumor prodrug. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||