98674-83-0
Chemical Structure
(-)-Anicyphos
- CAS No.: 98674-83-0
- Formula:C12H17O5P
- Molecular Weight:272.23
IUPAC Name: (4S)-2-hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaphosphinane 2-oxide
InChIKey: HNFXKRNIAWHFJN-LLVKDONJSA-N
SMILES: CC1(C)COP(=O)(O)O[C@@H]1C2=CC=CC=C2OC
Biological Activity: (-)-Anicyphos is a chiral catalyst with the activity of promoting the selectivity of specific reactions. (-)-Anicyphos is often used to synthesize complex chiral molecules in organic synthesis and shows excellent catalytic performance. By adjusting the reaction conditions, (-)-Anicyphos can significantly improve the stereospecificity of the product, providing an effective strategy for compound development.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(-)-Anicyphos | (-)-Anicyphos is a chiral catalyst with the activity of promoting the selectivity of specific reactions. (-)-Anicyphos is often used to synthesize complex chiral molecules in organic synthesis and shows excellent catalytic performance. By adjusting the reaction conditions, (-)-Anicyphos can significantly improve the stereospecificity of the product, providing an effective strategy for compound development. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||