1663449-60-2
Chemical Structure
Cy3-PEG2-endo-BCN
- CAS. Nr.: 1663449-60-2
- Formula:C47H63ClN4O5
- Molecular Weight:799.48
InChIKey: NPJOVZIYCMDQAT-RQPABJIYSA-N
SMILES: CC1(C)C2=CC=CC=C2[N+](CCCCCC(NCCOCCOCCNC(OC[C@H]3[C@]4([H])[C@@]3([H])CCC#CCC4)=O)=O)=C1/C=C/C=C5N(C6=CC=CC=C6C\5(C)C)C.[Cl-]
Biological Activity: Cy3-PEG2-endo-BCN is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) containing 2 PEG units. Cy3-PEG2-endo-BCN contains the lyophilic bidentate macrocyclic ligand endo-BCN, which can further synthesize macrocyclic complexes. In click chemistry, endo-BCN can react with molecules containing azide groups to form stable triazoles in the absence of catalysts.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cy3-PEG2-endo-BCN | 96.20% | Cy3-PEG2-endo-BCN is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) containing 2 PEG units. Cy3-PEG2-endo-BCN contains the lyophilic bidentate macrocyclic ligand endo-BCN, which can further synthesize macrocyclic complexes. In click chemistry, endo-BCN can react with molecules containing azide groups to form stable triazoles in the absence of catalysts. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cy3-PEG2-exo-BCN | Cy3-PEG2-exo-BCN is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) containing 2 PEG units. Cy3-PEG2-exo-BCN contains the lyophilic bidentate macrocyclic ligand BCN, which can further synthesize macrocyclic complexes. In click chemistry, exo-BCN can react with molecules containing azide groups to form stable triazoles in the absence of catalysts. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||