69-27-2
Chemical Structure
Chlorisondamine
- CAS No.: 69-27-2
- Formula:C14H20Cl6N2
- Molecular Weight:429.04
InChIKey: DXXUGBPKQDTBQW-UHFFFAOYSA-L
SMILES: ClC1=C(Cl)C(C[N+](C2)(CC[N+](C)(C)C)C)=C2C(Cl)=C1Cl.[Cl-].[Cl-]
Biological Activity: Chlorisondamine is a nicotinic antagonist that acts as a ganglionic blocker and has been utilized to evaluate the neurogenic contributions to blood pressure and sympathetic vasomotor tone in animal models. Chlorisondamine has demonstrated antihypertensive properties, primarily being assessed through its effects on blood pressure, cardiac output, and heart rate in various experimental settings, particularly in mice.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chlorisondamine | Chlorisondamine is a nicotinic antagonist that acts as a ganglionic blocker and has been utilized to evaluate the neurogenic contributions to blood pressure and sympathetic vasomotor tone in animal models. Chlorisondamine has demonstrated antihypertensive properties, primarily being assessed through its effects on blood pressure, cardiac output, and heart rate in various experimental settings, particularly in mice. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||