101627-01-4
Chemical Structure
Linear B trisaccharide
- CAS No.: 101627-01-4
- Formula:C20H35NO16
- Molecular Weight:545.49
InChIKey: NNISLDGFPWIBDF-LQHNAXJESA-N
SMILES: OC[C@@H](O[C@H]([C@@H]([C@H]1O)NC(C)=O)O)[C@H]1O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O[C@H]3O[C@@H]([C@@H]([C@@H]([C@H]3O)O)O)CO)O
Biological Activity: Linear B trisaccharide is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Linear B trisaccharide | Linear B trisaccharide is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||