108320-89-4
Chemical Structure
UDP-xylose disodium
- CAS No.: 108320-89-4
- Formula:C14H20N2Na2O16P2
- Molecular Weight:580.24
InChIKey: MGYLMPLCHMTESC-SMSDBRRYSA-L
SMILES: O[C@H]([C@H]([C@@H](CO1)O)O)[C@H]1OP(OP(OC[C@@H]2[C@@H](O)[C@@H](O)[C@H](N3C(NC(C=C3)=O)=O)O2)(O[Na])=O)(O[Na])=O
Biological Activity: UDP-xylose disodium is an endogenous sugar nucleotide and a catalytic substrate of UDP-xylose disodium synthase (UXS). UDP-xylose disodium is a sugar donor for the synthesis of glycoproteins, polysaccharides, various metabolites and oligosaccharides in plants, vertebrates and fungi, and participates in the synthesis of proteoglycans as a glycosyl donor. UDP-xylose disodium participates in the regulation of the synthesis of extracellular matrix components and can be used to study the mechanism of proteoglycan biosynthesis in glycobiology and related diseases (such as connective tissue diseases)[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
UDP-xylose disodium | 99.90% | UDP-xylose disodium is an endogenous sugar nucleotide and a catalytic substrate of UDP-xylose disodium synthase (UXS). UDP-xylose disodium is a sugar donor for the synthesis of glycoproteins, polysaccharides, various metabolites and oligosaccharides in plants, vertebrates and fungi, and participates in the synthesis of proteoglycans as a glycosyl donor. UDP-xylose disodium participates in the regulation of the synthesis of extracellular matrix components and can be used to study the mechanism of proteoglycan biosynthesis in glycobiology and related diseases (such as connective tissue diseases). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
