108979-07-3
Chemical Structure
FKB04
- CAS No.: 108979-07-3
- Formula:C17H15BrO4
- Molecular Weight:363.20
InChIKey: HULOKJPQNJZXKY-VOTSOKGWSA-N
SMILES: BrC1=CC(/C=C/C(C2=C(C=C(C=C2O)OC)OC)=O)=CC=C1
Biological Activity: FKB04 is a telomeric repeat binding factor 2 (TRF2) inhibitor that exerts its antitumor activity by disrupting the telomere maintenance mechanism in liver cancer cells, leading to T-loop defects, telomere shortening, and cellular senescence. Additionally, FKB04 can inhibit tumor growth in a human liver cancer xenograft mouse model (with Huh-7 cells implanted in BALB/c mice). FKB04 can be used in liver cancer research[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FKB04 | 99.98% | FKB04 is a telomeric repeat binding factor 2 (TRF2) inhibitor that exerts its antitumor activity by disrupting the telomere maintenance mechanism in liver cancer cells, leading to T-loop defects, telomere shortening, and cellular senescence. Additionally, FKB04 can inhibit tumor growth in a human liver cancer xenograft mouse model (with Huh-7 cells implanted in BALB/c mice). FKB04 can be used in liver cancer research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||