116872-05-0
Chemical Structure
Magnoloside B
- CAS No.: 116872-05-0
- Formula:C35H46O20
- Molecular Weight:786.73
IUPAC Name: (2R,3R,4R,5R,6R)-2-(3,4-dihydroxyphenethoxy)-5-hydroxy-6-((((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)methyl)-3-(((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-4-yl (E)-3-(
InChIKey: MGCIVWNKCIWQHX-SVOJIASLSA-N
SMILES: O[C@H]([C@@H](CO[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1)O2)[C@@H](OC(/C=C/C3=CC=C(O)C(O)=C3)=O)[C@@H](O[C@H]4[C@@H]([C@@H]([C@H]([C@H](C)O4)O)O)O)[C@@H]2OCCC5=CC=C(O)C(O)=C5
Biological Activity: Magnoloside B is an α-glucosidase inhibitor (IC50=0.69 mM), which can be obtained from Magnolia officinalis stem bark. Magnoloside B shows moderate inhibitory activity against MGC-803 and HepG2 cells. Magnoloside B has the potential to study cancer and diabetes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Magnoloside B | 98.40% | Magnoloside B is an α-glucosidase inhibitor (IC50=0.69 mM), which can be obtained from Magnolia officinalis stem bark. Magnoloside B shows moderate inhibitory activity against MGC-803 and HepG2 cells. Magnoloside B has the potential to study cancer and diabetes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
