12012-95-2
Chemical Structure
Allylpalladium(II) chloride dimer
- CAS No.: 12012-95-2
- Formula:C6H10Cl2Pd2
- Molecular Weight:365.89
InChIKey: PENAXHPKEVTBLF-UHFFFAOYSA-L
SMILES: [Pd+2]12([CH]3=[CH2]2)([CH2-]3)[Cl-][Pd+2]4([CH]5=[CH2]4)([CH2-]5)[Cl-]1
Biological Activity: Allylpalladium(II) chloride dimer is a palladium catalytic precursor that serves as a catalyst for the Heck reaction. Allylpalladium(II) chloride dimer is also a transition metal allyl complex[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Allylpalladium(II) chloride dimer | 98.0% | Allylpalladium(II) chloride dimer is a palladium catalytic precursor that serves as a catalyst for the Heck reaction. Allylpalladium(II) chloride dimer is also a transition metal allyl complex. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||