1216737-36-8
Chemical Structure
Nicotinuric acid-d4
- CAS No.: 1216737-36-8
- Formula:C8H4D4N2O3
- Molecular Weight:184.19
IUPAC Name: (nicotinoyl-2,4,5,6-d4)glycine
InChIKey: ZBSGKPYXQINNGF-RHQRLBAQSA-N
SMILES: OC(CNC(C1=C([2H])N=C([2H])C([2H])=C1[2H])=O)=O
Biological Activity: Nicotinuric acid-d4 is the 4-labeled Nicotinuric acid (HY-113353). Nicotinuric acid is an acylglycine and the major catabolite of nicotinic acid (HY-B0143). Its urinary levels correlate with body mass index, blood pressure, blood lipid parameters, and high-sensitivity C-reactive protein. Nicotinuric acid participates in coenzyme-related activities including glycolysis, gluconeogenesis, the citric acid cycle, oxidation, and long-chain fatty acid synthesis in various tissues. Nicotinuric acid is associated with the progression of metabolic syndrome to diabetes and atherosclerotic cardiovascular disease[1][2]
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Nicotinuric acid-d4 | 99.07% | Nicotinuric acid-d4 is the 4-labeled Nicotinuric acid (HY-113353). Nicotinuric acid is an acylglycine and the major catabolite of nicotinic acid (HY-B0143). Its urinary levels correlate with body mass index, blood pressure, blood lipid parameters, and high-sensitivity C-reactive protein. Nicotinuric acid participates in coenzyme-related activities including glycolysis, gluconeogenesis, the citric acid cycle, oxidation, and long-chain fatty acid synthesis in various tissues. Nicotinuric acid is associated with the progression of metabolic syndrome to diabetes and atherosclerotic cardiovascular disease[1] | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Nicotinuric acid (Standard) | 99.92% | Nicotinuric acid (Standard) is the analytical standard of Nicotinuric acid (HY-113353). This product is intended for research and analytical applications. Nicotinuric acid is an acylglycine and the major catabolite of nicotinic acid (HY-B0143). Its urinary levels correlate with body mass index, blood pressure, blood lipid parameters, and high-sensitivity C-reactive protein. Nicotinuric acid participates in coenzyme-related activities including glycolysis, gluconeogenesis, the citric acid cycle, oxidation, and long-chain fatty acid synthesis in various tissues. Nicotinuric acid is associated with the progression of metabolic syndrome to diabetes and atherosclerotic cardiovascular disease[1] | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Nicotinuric acid | 99.94% | Nicotinuric acid is an acylglycine and the major catabolite of nicotinic acid (HY-B0143). Its urinary levels correlate with body mass index, blood pressure, blood lipid parameters, and high-sensitivity C-reactive protein. Nicotinuric acid participates in coenzyme-related activities including glycolysis, gluconeogenesis, the citric acid cycle, oxidation, and long-chain fatty acid synthesis in various tissues. Nicotinuric acid is associated with the progression of metabolic syndrome to diabetes and atherosclerotic cardiovascular disease[1] | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
