1217723-41-5
Chemical Structure
Thiamphenicol-d3-1
Synonym(s): Thiophenicol-d3-1;Dextrosulphenidol-d3-1
- CAS No.: 1217723-41-5
- Formula:C12H12D3Cl2NO5S
- Molecular Weight:359.24
IUPAC Name: 4-azido-3-(benzyloxy)tetrahydro-2H-pyran
InChIKey: OTVAEFIXJLOWRX-SFUNZEOWSA-N
SMILES: ClC(Cl)C(N[C@@](C([2H])([2H])O)([2H])[C@@H](C1=CC=C(C=C1)S(C)(=O)=O)O)=O
Biological Activity: Thiamphenicol-d3-1 (Thiophenicol-d3-1; Dextrosulphenidol-d3-1) is the deuterium-labeled Thiamphenicol (HY-B0479)[1]. Thiamphenicol (Thiophenicol), a methyl-sulfonyl derivative of Chloramphenicol, is a broad-spectrum antimicrobial antibiotic. Thiamphenicol acts by binding to the 50S ribosomal subunit, leading to inhibition of protein synthesis and bacteriostatic effect (against Gram-negative, Gram-positive aerobic and anaerobic bacteria)[2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Thiamphenicol-d3-1 | 99.0% | Thiamphenicol-d3-1 (Thiophenicol-d3-1; Dextrosulphenidol-d3-1) is the deuterium-labeled Thiamphenicol (HY-B0479). Thiamphenicol (Thiophenicol), a methyl-sulfonyl derivative of Chloramphenicol, is a broad-spectrum antimicrobial antibiotic. Thiamphenicol acts by binding to the 50S ribosomal subunit, leading to inhibition of protein synthesis and bacteriostatic effect (against Gram-negative, Gram-positive aerobic and anaerobic bacteria). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
ent-Thiamphenicol | ent-Thiamphenicol (ent-Dextrosulphenidol) is a enantiomer of Thiamphenicol (HY-B0479). Thiamphenicol, a methyl-sulfonyl derivative of Chloramphenicol, is a broad-spectrum antimicrobial antibiotic. Thiamphenicol acts by binding to the 50S ribosomal subunit, leading to inhibition of protein synthesis and bacteriostatic effect (against Gram-negative, Gram-positive aerobic and anaerobic bacteria). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||