1217901-28-4
Chemical Structure
Arachidonic acid-biotin
- CAS No.: 1217901-28-4
- Formula:C35H58N4O3S
- Molecular Weight:614.93
IUPAC Name: (5Z,8Z,11Z,14Z)-N-(5-(5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)pentyl)icosa-5,8,11,14-tetraenamide
InChIKey: RPYSWRMECJXHSJ-QYXQEGSISA-N
SMILES: CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(N([H])CCCCCNC(CCCC[C@@H]1SC[C@@]([H])([C@@]1(N(C2=O)[H])[H])N2[H])=O)=O
Biological Activity: Arachidonic acid-Biotin is a biotin-labeled Arachidonic acid (HY-109590) that can be used to detect complexes of arachidonic acid with protein binding partners such as fatty acid binding proteins (FABPs)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arachidonic acid-biotin | 98.71% | Arachidonic acid-Biotin is a biotin-labeled Arachidonic acid (HY-109590) that can be used to detect complexes of arachidonic acid with protein binding partners such as fatty acid binding proteins (FABPs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||