124412-00-6
Chemical Structure
5-CFDA-AM
- CAS. Nr.: 124412-00-6
- Formula:C28H20O11
- Molecular Weight:532.45
IUPAC Name: 5-((acetoxymethoxy)carbonyl)-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-3',6'-diyl diacetate
InChIKey: YDBUJZYYYBVSEF-UHFFFAOYSA-N
SMILES: O=C(C1=CC2=C(C3(C4=C(OC5=C3C=CC(OC(C)=O)=C5)C=C(OC(C)=O)C=C4)OC2=O)C=C1)OCOC(C)=O
Biological Activity: 5-CFDA-AM is a cell-permeable esterase substrate that can be used as an active probe to measure enzyme activity and cell membrane integrity. 5-CFDA-AM is electroneutral and can enter the cell at a lower concentration than CFDA, where it is hydrolysed by intracellular esterases to produce carboxyfluorescein, which contains an additional negative charge and can be better retained in the cell. 5-CFDA-AM can be used to detect cell viability[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-CFDA-AM | 98.27% | 5-CFDA-AM is a cell-permeable esterase substrate that can be used as an active probe to measure enzyme activity and cell membrane integrity. 5-CFDA-AM is electroneutral and can enter the cell at a lower concentration than CFDA, where it is hydrolysed by intracellular esterases to produce carboxyfluorescein, which contains an additional negative charge and can be better retained in the cell. 5-CFDA-AM can be used to detect cell viability. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||