1245823-51-1
Chemical Structure
Propargyl-PEG5-acid
- CAS No.: 1245823-51-1
- Formula:C14H24O7
- Molecular Weight:304.34
IUPAC Name: 4,7,10,13,16-pentaoxanonadec-18-ynoic acid
InChIKey: GWIACWQVTBMVEI-UHFFFAOYSA-N
SMILES: O=C(O)CCOCCOCCOCCOCCOCC#C
Biological Activity: Propargyl-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG5-acid can used to synthesize ADC inhibitors of Galectin-3. Propargyl-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Propargyl-PEG5-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG5-acid | 99.82% | Propargyl-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG5-acid can used to synthesize ADC inhibitors of Galectin-3. Propargyl-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG5-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG5-acid (Standard) | ≥98% | Propargyl-PEG5-acid (Standard) is the analytical standard of Propargyl-PEG5-acid (HY-101157). This product is intended for research and analytical applications. Propargyl-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG5-acid can used to synthesize ADC inhibitors of Galectin-3. Propargyl-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG5-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
