126695-58-7
Chemical Structure
4-N3Pfp-NHS ester
- CAS No.: 126695-58-7
- Formula:C11H4F4N4O4
- Molecular Weight:332.17
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 4-azido-2,3,5,6-tetrafluorobenzoate
InChIKey: HCTLWQSYGIBOFM-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)C2=C(F)C(F)=C(N=[N+]=[N-])C(F)=C2F
Biological Activity: 4-N3Pfp-NHS ester is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. 4-N3Pfp-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-N3Pfp-NHS ester | 97.95% | 4-N3Pfp-NHS ester is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). 4-N3Pfp-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||