12699-00-2
Chemical Structure
Trichomycin B
- CAS No.: 12699-00-2
- Formula:C58H84N2O18
- Molecular Weight:1097.29
InChIKey: LWTOHQGGAJCWFV-WYXOKDNXSA-N
SMILES: O=C1CC(CCCC(O)CC(O)CC(O)CC(O)CC2(O)OC(C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(C(C(C)CCC(O)CC(C4=CC=C(N)C=C4)=O)O1)C)C(C(O)=O)C(O)C2)=O
Biological Activity: Trichomycin B is a polyene macrolide antibiotic that can be isolated from the fermentation products of Streptomyces hachijoensis. Trichomycin B exhibits antibacterial activity against fungi, yeasts, and trichomonas. Trichomycin B can be used in research on antifungal and anti-trichomoniasis infection[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trichomycin B | Trichomycin B is a polyene macrolide antibiotic that can be isolated from the fermentation products of Streptomyces hachijoensis. Trichomycin B exhibits antibacterial activity against fungi, yeasts, and trichomonas. Trichomycin B can be used in research on antifungal and anti-trichomoniasis infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
