1356841-89-8
Chemical Structure
Tacrolimus-13C,d2
Synonym(s): FK506-13C,d2;Fujimycin-13C,d2;FR900506-13C,d2
- CAS. Nr.: 1356841-89-8
- Formula:C4313CH67D2NO12
- Molecular Weight:807.02
InChIKey: QJJXYPPXXYFBGM-QNEHJXMKSA-N
SMILES: O=C(O[C@@H]([C@@H]([C@H](CC1=O)O)C)/C(C)=C/[C@H]2C[C@H]([C@@H](CC2)O)OC)[C@]3([H])CCCCN3C(C([C@]4([C@@H](C[C@@H]([C@@]([H])([C@H](C[C@H](C/C(C)=C/[C@H]1C/C=[13C]([2H])\[2H])C)OC)O4)OC)C)O)=O)=O
Biological Activity: Tacrolimus-13C,d2 (FK506-13C,d2) is the 13C, deuterated-labeled Tacrolimus (HY-13756). Tacrolimus (FK506), a molecular glue, a macrocyclic lactone, binds to FK506 binding protein (FKBP) to form a complex. Tacrolimus inhibits calcineurin phosphatase, which inhibits T-lymphocyte signal transduction and IL-2 transcription. Immunosuppressive properties[1][6].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tacrolimus-13C,d2 | 98.36% | Tacrolimus-13C,d2 (FK506-13C,d2) is the 13C, deuterated-labeled Tacrolimus (HY-13756). Tacrolimus (FK506), a molecular glue, a macrocyclic lactone, binds to FK506 binding protein (FKBP) to form a complex. Tacrolimus inhibits calcineurin phosphatase, which inhibits T-lymphocyte signal transduction and IL-2 transcription. Immunosuppressive properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tacrolimus (Standard) | 99.60% | Tacrolimus (Standard) (FK506 (Standard); Fujimycin (Standard); FR900506 (Standard)) is the analytical standard of Tacrolimus (HY-13756). This product is intended for research and analytical applications. Tacrolimus (FK506), a molecular glue, a macrocyclic lactone, binds to FK506 binding protein (FKBP) to form a complex. Tacrolimus inhibits calcineurin phosphatase, which inhibits T-lymphocyte signal transduction and IL-2 transcription. Immunosuppressive properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tacrolimus-d3 | Tacrolimus-d3 (FK506-d3) is the deuterated-labeled Tacrolimus (HY-13756). Tacrolimus (FK506), a molecular glue, a macrocyclic lactone, binds to FK506 binding protein (FKBP) to form a complex. Tacrolimus inhibits calcineurin phosphatase, which inhibits T-lymphocyte signal transduction and IL-2 transcription. Immunosuppressive properties. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tacrolimus | 99.93% | Tacrolimus (FK506), a molecular glue, a macrocyclic lactone, binds to FK506 binding protein (FKBP) to form a complex. Tacrolimus inhibits calcineurin phosphatase, which inhibits T-lymphocyte signal transduction and IL-2 transcription. Immunosuppressive properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||