139290-36-1
Chemical Structure
Uric acid-13C
- CAS No.: 139290-36-1
- Formula:C413CH4N4O3
- Molecular Weight:169.10
InChIKey: LEHOTFFKMJEONL-AZXPZELESA-N
SMILES: O=C1C2=C(NC(N1)=O)N[13C](N2)=O
Biological Activity: Uric acid-13C is the 13C-labeled Uric acid (HY-B2130). Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation[1][2].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Uric acid-13C | Uric acid-13C is the 13C-labeled Uric acid (HY-B2130). Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid (Standard) | 99.98% | Uric acid (Standard) is the analytical standard of Uric acid. This product is intended for research and analytical applications. Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid-13C,15N3 | Uric acid-13C,15N3 is the 13C-labeled and 15N-labeled Uric acid. Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid-15N2 | 99.95% | Uric acid-15N2 is the 15N labeled Uric acid. Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid | 99.92% | Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||