1418217-95-4
Chemical Structure
DBCO-Biotin
- CAS No.: 1418217-95-4
- Formula:C28H30N4O3S
- Molecular Weight:502.63
InChIKey: ODZDNKWGVJPVBP-DPPGTGKWSA-N
SMILES: O=C1N[C@](CS2)([H])[C@@](N1)([H])[C@@H]2CCCCC(NCCC(N3C4=CC=CC=C4C#CC5=CC=CC=C5C3)=O)=O
Biological Activity: DBCO-Biotin is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. DBCO-Biotin is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DBCO-Biotin | 97.42% | DBCO-Biotin is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. DBCO-Biotin is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||