1425944-33-7
Chemical Structure
CYD-4-61
- CAS No.: 1425944-33-7
- Formula:C21H17N3O3
- Molecular Weight:359.38
IUPAC Name: (E)-2-((3-((2-nitro-9H-fluoren-9-ylidene)methyl)pyridin-2-yl)oxy)ethan-1-amine
InChIKey: PSTOZJZIPPUYHT-XDHOZWIPSA-N
SMILES: NCCOC1=NC=CC=C1/C=C2C3=C(C4=C/2C=CC=C4)C=CC([N+]([O-])=O)=C3
Biological Activity: CYD-4-61 is a novel Bax activator used for breast cancer research. CYD-4-61 inhibits triple-negative breast cancer MDA-MB-231 and ER-positive breast cancer MCF-7 cell lines proliferation. CYD-4-61 activates Bax protein to induce cytochrome c release and regulate apoptotic biomarkers, leading to cancer cell apoptosis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CYD-4-61 | 98.41% | CYD-4-61 is a novel Bax activator used for breast cancer research. CYD-4-61 inhibits triple-negative breast cancer MDA-MB-231 and ER-positive breast cancer MCF-7 cell lines proliferation. CYD-4-61 activates Bax protein to induce cytochrome c release and regulate apoptotic biomarkers, leading to cancer cell apoptosis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||