1471982-33-8
Chemical Structure
YADA
Synonym(s): Lucifer Yellow 3-amino-D-alanine
- CAS No.: 1471982-33-8
- Formula:C15H13N3O10S2
- Molecular Weight:459.41
IUPAC Name: (R)-2-amino-3-(6-amino-1,3-dioxo-5,8-disulfo-1H-benzo[de]isoquinolin-2(3H)-yl)propanoic acid
InChIKey: YXWYHJBYHLJEIR-SECBINFHSA-N
SMILES: O=C1C2=CC(S(=O)(O)=O)=C(N)C3=C2C(C(N1C[C@@H](N)C(O)=O)=O)=CC(S(=O)(O)=O)=C3
Biological Activity: YADA (Lucifer Yellow 3-amino-D-alanine) is a conjugate of the fluorescent dyes Lucifer yellow and D-alanine, which is a green-yellow fluorescent dye. YADA is suitable for labeling peptidoglycans in living bacteria that can be incorporated into the cell wall where they are being synthesized. YADA has a large Stokes shift and a wide emission spectrum, allowing excitation through a purple light source and detection using a green filter. YADA showed good water solubility, light stability and thermal stability.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
YADA | YADA (Lucifer Yellow 3-amino-D-alanine) is a conjugate of the fluorescent dyes Lucifer yellow and D-alanine, which is a green-yellow fluorescent dye. YADA is suitable for labeling peptidoglycans in living bacteria that can be incorporated into the cell wall where they are being synthesized. YADA has a large Stokes shift and a wide emission spectrum, allowing excitation through a purple light source and detection using a green filter. YADA showed good water solubility, light stability and thermal stability. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||