14783-68-7
Chemical Structure
Magnesium glycinate
Synonym(s): Magnesium bisglycinate; Magnesium diglycinate
- CAS No.: 14783-68-7
- Formula:C4H8MgN2O4
- Molecular Weight:172.42
InChIKey: AACACXATQSKRQG-UHFFFAOYSA-L
SMILES: O=C1[O-][Mg+2]([NH2]C2)([NH2]C1)[O-]C2=O
Biological Activity: Magnesium glycinate (Magnesium bisglycinate), the magnesium salt of glycine, is a nutrient supplement. Magnesium glycinate has satisfactory physico-chemical properties and bioactivities. Metal glycinate chelates are formed by glycine and metal compounds through chemical reactions. Magnesium is an essential mineral that plays a critical role in the human body. Magnesium takes part in the process of energy metabolism and assists the maintenance of normal muscle function[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Magnesium glycinate | 98.0% | Magnesium glycinate (Magnesium bisglycinate), the magnesium salt of glycine, is a nutrient supplement. Magnesium glycinate has satisfactory physico-chemical properties and bioactivities. Metal glycinate chelates are formed by glycine and metal compounds through chemical reactions. Magnesium is an essential mineral that plays a critical role in the human body. Magnesium takes part in the process of energy metabolism and assists the maintenance of normal muscle function. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
