14836-73-8
Chemical Structure
Ferrioxamine B
- CAS No.: 14836-73-8
- Formula:C25H45FeN6O8
- Molecular Weight:613.51
InChIKey: SRMBQCVUAVULDJ-UHFFFAOYSA-N
SMILES: NCCCCCN1[O-][Fe+3]23([O]=C1CCC4=O)([O-]N(CCCCCN5)C(C)=[O]3)[O-]N(CCCCCN4)C(CCC5=O)=[O]2
Biological Activity: Ferrioxamine B is a bacterial desferrioxamine siderophore produced by actinomycetes. Ferrioxamine B acts as a ligand for FpvB and FoxA, and is transported into Pseudomonas aeruginosa via the FpvB and FoxA transporters. Ferrioxamine B competitively binds to FpvB, thereby antagonizing the uptake of thiostrepton into Pseudomonas aeruginosa. Ferrioxamine B can provide an iron source to support the growth of Pseudomonas aeruginosa under iron-limiting conditions[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ferrioxamine B | Ferrioxamine B is a bacterial desferrioxamine siderophore produced by actinomycetes. Ferrioxamine B acts as a ligand for FpvB and FoxA, and is transported into Pseudomonas aeruginosa via the FpvB and FoxA transporters. Ferrioxamine B competitively binds to FpvB, thereby antagonizing the uptake of thiostrepton into Pseudomonas aeruginosa. Ferrioxamine B can provide an iron source to support the growth of Pseudomonas aeruginosa under iron-limiting conditions. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
