155179-21-8
Chemical Structure
Vanicoside B
- CAS No.: 155179-21-8
- Formula:C49H48O20
- Molecular Weight:956.89
IUPAC Name: ((2S,3S,4R,5R)-4-hydroxy-3-(((E)-3-(4-hydroxyphenyl)acryloyl)oxy)-2-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((((E)-3-(4-hydroxy-3-methoxyphenyl)acryloyl)oxy)methyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydrofuran-2,5-diyl)bis(methylene) (2E,2'E)-bis(3-(4-hydrox
InChIKey: ALSDWGAQQGXOHC-PWYSLETCSA-N
SMILES: OC(C=C1)=CC=C1/C=C/C(OC[C@@]2([C@H]([C@@H]([C@H](O2)COC(/C=C/C3=CC=C(C=C3)O)=O)O)OC(/C=C/C4=CC=C(C=C4)O)=O)O[C@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)COC(/C=C/C6=CC(OC)=C(C=C6)O)=O)=O
Biological Activity: Vanicoside B is a phenylpropanoyl sucrose derivative, can be isolated from the herb Persicaria dissitiflora. Vanicoside B targets cyclin-dependent kinase 8 (CDK8) and exhibits anti-tumor activity. The potential mechanism is Vanicoside B blocks CDK8-mediated signaling pathways and decreases the expression of epithelial-mesenchymal transition proteins, so that it leads to cell cycle arrest and apoptosis[1][2].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Vanicoside B | 95.51% | Vanicoside B is a phenylpropanoyl sucrose derivative, can be isolated from the herb Persicaria dissitiflora. Vanicoside B targets cyclin-dependent kinase 8 (CDK8) and exhibits anti-tumor activity. The potential mechanism is Vanicoside B blocks CDK8-mediated signaling pathways and decreases the expression of epithelial-mesenchymal transition proteins, so that it leads to cell cycle arrest and apoptosis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Kim D, et al. Antitumor Activity of Vanicoside B Isolated from Persicaria dissitiflora by Targeting CDK8 in Triple-Negative Breast Cancer Cells. J Nat Prod. 2019 Nov 22;82(11):3140-3149. [Content Brief]
- [2]. Takasaki M, et al. Cancer chemopreventive activity of phenylpropanoid esters of sucrose, vanicoside B and lapathoside A, from Polygonum lapathifolium. Cancer Lett. 2001 Nov 28;173(2):133-8. [Content Brief]