155205-90-6
Chemical Structure
17-Phenyl trinor Prostaglandin F2α dimethyl amide
Synonym(s): Bimatoprost dimethyl amide
- CAS No.: 155205-90-6
- Formula:C25H37NO4
- Molecular Weight:415.57
InChIKey: BISWUUSSYMZAQK-FTOWTWDKSA-N
SMILES: CN(C)C(CCC/C=C\C[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)/C=C/[C@@H](O)CCC2=CC=CC=C2)=O
Biological Activity: 17-Phenyl trinor Prostaglandin F2α dimethyl amide (Bimatoprost dimethyl amide), a 1-OH cyclopentane heptanoic acid, 2-(cycloalkyl or arylalkyl) derivative, is a smooth muscle relaxant. 17-Phenyl trinor Prostaglandin F2α dimethyl amide has the potential for glaucoma research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
17-Phenyl trinor Prostaglandin F2α dimethyl amide | 17-Phenyl trinor Prostaglandin F2α dimethyl amide (Bimatoprost dimethyl amide), a 1-OH cyclopentane heptanoic acid, 2-(cycloalkyl or arylalkyl) derivative, is a smooth muscle relaxant. 17-Phenyl trinor Prostaglandin F2α dimethyl amide has the potential for glaucoma research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||