15709-76-9
Chemical Structure
Chlorotris(triphenylphosphine)copper
Synonym(s): CuCl(TPP)3
- CAS No.: 15709-76-9
- Formula:C54H45ClCuP3
- Molecular Weight:885.86
InChIKey: QHNOTJLPMUDWAG-UHFFFAOYSA-P
SMILES: [Cl-][Cu+]([P](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)([P](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)[P](C7=CC=CC=C7)(C8=CC=CC=C8)C9=CC=CC=C9
Biological Activity: Chlorotris(triphenylphosphine)copper (CuCl(TPP)₃) is a DNA-targeted metal complex. Chlorotris(triphenylphosphine)copper involves non-covalent interactions (such as groove binding mode) through the copper(I) center to affect DNA function, showing inhibitory activity against bacteria, fungi, and tumor cells. Chlorotris(triphenylphosphine)copper is promising for research of antibacterial, antitumor, and antioxidant agents[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chlorotris(triphenylphosphine)copper | 98.0% | Chlorotris(triphenylphosphine)copper (CuCl(TPP)₃) is a DNA-targeted metal complex. Chlorotris(triphenylphosphine)copper involves non-covalent interactions (such as groove binding mode) through the copper(I) center to affect DNA function, showing inhibitory activity against bacteria, fungi, and tumor cells. Chlorotris(triphenylphosphine)copper is promising for research of antibacterial, antitumor, and antioxidant agents. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||