1817735-39-9
Chemical Structure
Azido-PEG2-C2-sulfonic acid
- CAS No.: 1817735-39-9
- Formula:C6H13N3O5S
- Molecular Weight:239.25
IUPAC Name: 2-(2-(2-azidoethoxy)ethoxy)ethane-1-sulfonic acid
InChIKey: GBEOYHHTRHXIRM-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCS(=O)(O)=O
Biological Activity: Azido-PEG2-C2-sulfonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG2-C2-sulfonic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG2-C2-sulfonic acid | Azido-PEG2-C2-sulfonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG2-C2-sulfonic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
