1818294-30-2
Chemical Structure
Trityl-PEG8-azide
- CAS No.: 1818294-30-2
- Formula:C35H47N3O8
- Molecular Weight:637.76
IUPAC Name: 25-azido-1,1,1-triphenyl-2,5,8,11,14,17,20,23-octaoxapentacosane
InChIKey: GMEFSMLZCBKWDL-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Biological Activity: Trityl-PEG8-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Trityl-PEG8-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trityl-PEG8-azide | Trityl-PEG8-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Trityl-PEG8-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||