1821136-07-5
Chemical Structure
CYP1A1 inhibitor 8a
- CAS No.: 1821136-07-5
- Formula:C17H17NO4
- Molecular Weight:299.32
IUPAC Name: (E)-1-(pyridin-4-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one
InChIKey: LTMMHRRDZVGAIL-SNAWJCMRSA-N
SMILES: O=C(C1=CC=NC=C1)/C=C/C2=CC(OC)=C(OC)C(OC)=C2
Biological Activity: CYP1A1 inhibitor 8a is a compound that potently and selectively inhibits the CYP1A1 enzyme and has the potential to prevent cancer. CYP1A1 inhibitor 8a exhibits more than 10-fold selectivity for CYP1A1 and more than 100-fold selectivity over other enzymes in the CYP1 subfamily. CYP1A1 inhibitor 8a can effectively antagonize B[a]P-mediated activation of the aryl hydrocarbon receptor (AhR) in yeast cells and protect human cells from CYP1A1-mediated B[a]P toxicity. CYP1A1 inhibitor 8a has the potential to be developed as a cancer chemopreventive agent[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CYP1A1 inhibitor 8a | 98.00% | CYP1A1 inhibitor 8a is a compound that potently and selectively inhibits the CYP1A1 enzyme and has the potential to prevent cancer. CYP1A1 inhibitor 8a exhibits more than 10-fold selectivity for CYP1A1 and more than 100-fold selectivity over other enzymes in the CYP1 subfamily. CYP1A1 inhibitor 8a can effectively antagonize B[a]P-mediated activation of the aryl hydrocarbon receptor (AhR) in yeast cells and protect human cells from CYP1A1-mediated B[a]P toxicity. CYP1A1 inhibitor 8a has the potential to be developed as a cancer chemopreventive agent. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||