1884551-35-2
Chemical Structure
T-1228
- CAS No.: 1884551-35-2
- Formula:C23H27N3O7
- Molecular Weight:457.48
InChIKey: PLHLITBEWJAPSE-GZAZMHIXSA-N
SMILES: O=C(N(C)[C@](C(NC)=O)(C)C(NO)=O)C(C=C1)=CC=C1C#CC2=CC=C([C@H](O)CO)C=C2.O
Biological Activity: T-1228 is a highly selective LpxC inhibitor. T-1228 can effectively block the synthesis of LPS (HY-D1056), causing defects in the bacterial outer membrane structure, increasing membrane permeability, and ultimately leading to bacterial cell death. T-1228 can be used for the study of Gram-negative bacterial infections[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
T-1228 | T-1228 is a highly selective LpxC inhibitor. T-1228 can effectively block the synthesis of LPS (HY-D1056), causing defects in the bacterial outer membrane structure, increasing membrane permeability, and ultimately leading to bacterial cell death. T-1228 can be used for the study of Gram-negative bacterial infections. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||