19031-56-2
Chemical Structure
Pimelic acid-d4
Synonym(s): Heptanedioic acid-d4;1,5-Pentanedicarboxylic acid-d4;1,7-Heptanedioic acid-d4
- CAS No.: 19031-56-2
- Formula:C7H8D4O4
- Molecular Weight:164.19
IUPAC Name: heptanedioic-2,2,6,6-d4 acid
InChIKey: WLJVNTCWHIRURA-CQOLUAMGSA-N
SMILES: OC(C([2H])([2H])CCCC([2H])([2H])C(O)=O)=O
Biological Activity: Pimelic acid-d4 is the deuterium labeled Pimelic acid[1]. Pimelic acid is the organic compound and its derivatives are involved in the biosynthesis of the amino acid called lysine.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pimelic acid-d4 | Pimelic acid-d4 is the deuterium labeled Pimelic acid. Pimelic acid is the organic compound and its derivatives are involved in the biosynthesis of the amino acid called lysine. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||