1937270-46-6
Chemical Structure
PC Biotin-PEG3-azide
- CAS No.: 1937270-46-6
- Formula:C35H55N9O12S
- Molecular Weight:825.93
IUPAC Name: 1-(4-((4,18-dioxo-22-((3aR,4R,6aS)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-8,11,14-trioxa-5,17-diazadocosyl)oxy)-5-methoxy-2-nitrophenyl)ethyl (3-azidopropyl)carbamate
InChIKey: PTNZFIYMARMNDM-CQIHFZOUSA-N
SMILES: O=C(OC(C1=CC(OC)=C(OCCCC(NCCOCCOCCOCCNC(CCCC[C@H]2SC[C@@]([C@@]2([H])N3)([H])NC3=O)=O)=O)C=C1[N+]([O-])=O)C)NCCCN=[N+]=[N-]
Biological Activity: PC Biotin-PEG3-azide is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. PC Biotin-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PC Biotin-PEG3-azide | 97.75% | PC Biotin-PEG3-azide is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). PC Biotin-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||