1977557-97-3
Chemical Structure
SC239
- CAS No.: 1977557-97-3
- Formula:C65H84N10O11
- Molecular Weight:1181.42
InChIKey: ZMSFFQZNTRZZJB-QUAMOIMISA-N
SMILES: O=C(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)CCC(N[C@@H](C(C)C)C(N[C@@H](CCCNC(N)=O)C(NC(C=C4)=CC=C4COC(NC5=CC(C(C)(C)[C@H](NC)C(N[C@@H](C(C)(C)C)C(N(C)[C@@H](C(C)C)/C=C(C)/C(O)=O)=O)=O)=CC=C5)=O)=O)=O)=O
Biological Activity: SC239 is a cleavable 2-aminophenyl hemiasterlin agent-linker. SC239 can be as the agent-linker for ADC[1]. SC239 is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
SC239 | 99.97% | SC239 is a cleavable 2-aminophenyl hemiasterlin agent-linker. SC239 can be as the agent-linker for ADC. SC239 is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||