201467-81-4
Chemical Structure
N33-TEG-COOH
Synonym(s): N3-TEG-COOH; 14-Azido-3,6,9,12-tetraoxatetradecanoic acid
- CAS No.: 201467-81-4
- Formula:C10H19N3O6
- Molecular Weight:277.27
IUPAC Name: 14-azido-3,6,9,12-tetraoxatetradecanoic acid
InChIKey: YHTABJLSZLHRFV-UHFFFAOYSA-N
SMILES: O=C(O)COCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: N33-TEG-COOH (N3-TEG-COOH) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. N33-TEG-COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N33-TEG-COOH | 98.55% | N33-TEG-COOH (N3-TEG-COOH) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. N33-TEG-COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N33-TEG-COOH (Standard) | ≥98% | N33-TEG-COOH (Standard) is the analytical standard of N33-TEG-COOH (HY-108370). This product is intended for research and analytical applications. N33-TEG-COOH (N3-TEG-COOH) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. N33-TEG-COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
