202114-66-7
Chemical Structure
L-Cysteine-13C3
- CAS No.: 202114-66-7
- Formula:13C3H7NO2S
- Molecular Weight:124.14
IUPAC Name: L-cysteine-13C3
InChIKey: XUJNEKJLAYXESH-GCCOVPGMSA-N
SMILES: O[13C]([13C@@H](N)[13CH2]S)=O
Biological Activity: L-Cysteine-13C3 is the 13C-labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Cysteine-13C3 | 99.9% | L-Cysteine-13C3 is the 13C-labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine (Standard) | 99.89% | L-Cysteine (Standard) is the analytical standard of L-Cysteine. This product is intended for research and analytical applications. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-d3 | 99.2% | L-Cysteine-d3 is the deuterium labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-d3,15N | L-Cysteine-d3,15N is the deuterium and 15N-labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-13C3,15N,d3 | L-Cysteine-13C3,15N,d3 is the deuterium, 13C-, and 15-labeled L-Isoleucine (HY-Y0337). L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-d2 | 98.0% | L-Cysteine-d2 is the deuterium labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-3-13C | 98.5% | L-Cysteine-3-13C is the 13C-labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-13C3,15N | 99.9% | L-Cysteine-13C3,15N is the 13C- and 15N-labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-1-13C | 99.0% | L-Cysteine-1-13C is the 13C-labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine-15N | 98.7% | L-Cysteine-15N is the 15N-labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Cysteine | 97.0% | L-Cysteine (Cysteine) is an orally active conditionally essential amino acid with hypoglycemic effects, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine promotes the proliferation and differentiation of neural stem cells via the CBS/H2S pathway. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans. L-Cysteine can be used as an anorectic agent. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||