2140263-19-8
Chemical Structure
Oseltamivir-d5 (hydrochloride)
Synonym(s): GS 4104-d5 hydrochloride
- CAS No.: 2140263-19-8
- Formula:C16H24D5ClN2O4
- Molecular Weight:353.90
IUPAC Name: 1-benzhydryl-5-hydroxy-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione
InChIKey: OHEGLAHLLCJYPX-DPDNDPGGSA-N
SMILES: CCC(CC)O[C@H]1[C@@H]([C@H](CC(C(OC([2H])([2H])C([2H])([2H])[2H])=O)=C1)N)NC(C)=O.Cl
Biological Activity: Oseltamivir-d5 (hydrochloride) is the deuterium labeled Oseltamivir hydrochloride[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Oseltamivir-d5 (hydrochloride) | Oseltamivir-d5 (hydrochloride) is the deuterium labeled Oseltamivir hydrochloride. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Oseltamivir (Standard) | 99.90% | Oseltamivir (Standard) is the analytical standard of Oseltamivir. This product is intended for research and analytical applications. Oseltamivir (GS 4104) is an orally active influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Oseltamivir-d3 | 99.13% | Oseltamivir-d3 is a deuterium labeled Oseltamivir. Oseltamivir is an influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively. Anti-influenza A and B agent. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Oseltamivir-d5 | 99.98% | Oseltamivir-d5 is the deuterium labeled Oseltamivir. Oseltamivir is an influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50 of 0.67, 0.9, 1.34 and 13 nM, respectively. Anti-influenza A and B agent. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Oseltamivir-d3 hydrochloride | Oseltamivir-d3 hydrochloride is the deuterium-labeled Oseltamivir (HY-13317). Oseltamivir is an influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively. Anti-influenza A and B agent. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Oseltamivir-d3-1 | Oseltamivir-d3-1 is the deuterium labeled Oseltamivir. Oseltamivir is an influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively. Anti-influenza A and B agent. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Oseltamivir | 99.94% | Oseltamivir (GS 4104) is an orally active influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||