216971-58-3
Chemical Structure
3-Indolyl-β-D-glucuronide cyclohexanamine
- CAS No.: 216971-58-3
- Formula:C20H28N2O7
- Molecular Weight:408.45
IUPAC Name: cyclohexanamine (2S,3S,4S,5R,6S)-6-((1H-indol-3-yl)oxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylate
InChIKey: YGIPNZMTCTUCAX-CYRSAHDMSA-N
SMILES: OC([C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC2=CNC3=CC=CC=C23)=O.NC4CCCCC4
Biological Activity: 3-Indolyl-β-D-glucuronide cyclohexanamine is the glucose component of X-Gluc staining buffer. 3-Indolyl-β-D-glucuronide cyclohexanamine can be used to detect gene expression. The active ingredient of the stain, β-Glucuronidase (GUS), reacts with the enzyme, causing the target gene to appear blue-purple in tissues or cells, so that the expression level and tissue distribution of the gene can be visually observed[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Indolyl-β-D-glucuronide cyclohexanamine | 98.41% | 3-Indolyl-β-D-glucuronide cyclohexanamine is the glucose component of X-Gluc staining buffer. 3-Indolyl-β-D-glucuronide cyclohexanamine can be used to detect gene expression. The active ingredient of the stain, β-Glucuronidase (GUS), reacts with the enzyme, causing the target gene to appear blue-purple in tissues or cells, so that the expression level and tissue distribution of the gene can be visually observed. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
