2183440-43-7
Chemical Structure
Sulfo-Cy3 amine
Synonym(s): Sulfo-Cyanine3 amine
- CAS No.: 2183440-43-7
- Formula:C36H50N4O7S2
- Molecular Weight:714.93
IUPAC Name: 1-(6-((6-aminohexyl)amino)-6-oxohexyl)-3,3-dimethyl-2-((E)-3-((Z)-1,3,3-trimethyl-5-sulfoindolin-2-ylidene)prop-1-en-1-yl)-3H-indol-1-ium-5-sulfonate
InChIKey: ZVOZJQQPUBRDRD-UHFFFAOYSA-N
SMILES: O=C(CCCCC[N+]1=C(/C=C/C=C2N(C)C3=CC=C(S(=O)(O)=O)C=C3C\2(C)C)C(C)(C)C4=C1C=CC(S(=O)([O-])=O)=C4)NCCCCCCN
Biological Activity: Sulfo-Cy3 amine is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The amine functionality of Sulfo-Cy3 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy3 amine can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sulfo-Cy3 amine | 98.03% | Sulfo-Cy3 amine is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The amine functionality of Sulfo-Cy3 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy3 amine can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
