2190506-29-5
Chemical Structure
DNA relaxation-IN-1
- CAS No.: 2190506-29-5
- Formula:C30H27N3O2S
- Molecular Weight:493.62
InChIKey: XAAIDHPZKXBLMF-VAWYXSNFSA-N
SMILES: O=C(C1=CC=CS1)/C=C/C2=CC(C(C3=C(C)NC4=C3C=CC=C4)C(C#N)=C(N)O5)=C5C(C(C)(C)C)=C2
Biological Activity: DNA relaxation-IN-1 (Compound 27) is a DNA ligase 1 DNA Lig1) inhibitor. DNA relaxation-IN-1 inhibits DNA ligation and disrupts the DNA relaxing activity of DNA Lig1. DNA relaxation-IN-1 induces Apoptosis. DNA relaxation-IN-1, in combination with Topotecan (HY-13768), exhibits synergistic antiproliferative effects against colorectal cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DNA relaxation-IN-1 | 98.61% | DNA relaxation-IN-1 (Compound 27) is a DNA ligase 1 DNA Lig1) inhibitor. DNA relaxation-IN-1 inhibits DNA ligation and disrupts the DNA relaxing activity of DNA Lig1. DNA relaxation-IN-1 induces Apoptosis. DNA relaxation-IN-1, in combination with Topotecan (HY-13768), exhibits synergistic antiproliferative effects against colorectal cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||