2253733-10-5
Chemical Structure
HADA hydrochloride
Synonym(s): HCC-Amino-D-alanine hydrochloride
- CAS No.: 2253733-10-5
- Formula:C13H13ClN2O6
- Molecular Weight:328.71
IUPAC Name: (R)-2-amino-3-(7-hydroxy-2-oxo-2H-chromene-3-carboxamido)propanoic acid hydrochloride
InChIKey: PLVOEKQNBIXHDI-SBSPUUFOSA-N
SMILES: N[C@H](CNC(C1=CC2=CC=C(O)C=C2OC1=O)=O)C(O)=O.[H]Cl
Biological Activity: HADA hydrochloride (HCC-Amino-D-alanine hydrochloride) is a blue (λem~450 nm) fluorescent D-amino acid (FDAA). FDAAs are efficiently incorporated into the peptidoglycans (PGs) of diverse bacterial species at the sites of PG biosynthesis, allowing specific and covalent probing of bacterial growth with minimal perturbation[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
HADA hydrochloride | 98.01% | HADA hydrochloride (HCC-Amino-D-alanine hydrochloride) is a blue (λem~450 nm) fluorescent D-amino acid (FDAA). FDAAs are efficiently incorporated into the peptidoglycans (PGs) of diverse bacterial species at the sites of PG biosynthesis, allowing specific and covalent probing of bacterial growth with minimal perturbation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
HADA hydrochloride (solution) | HADA hydrochloride (HCC-Amino-D-alanine hydrochloride) is a blue (λem~450 nm) fluorescent D-amino acid (FDAA). FDAAs are efficiently incorporated into the peptidoglycans (PGs) of diverse bacterial species at the sites of PG biosynthesis, allowing specific and covalent probing of bacterial growth with minimal perturbation. Solvent and concentration: DMSO: 50 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
