2255341-36-5
Chemical Structure
PARP1-IN-50
- CAS No.: 2255341-36-5
- Formula:C22H26Br2N6O4S2
- Molecular Weight:662.42
InChIKey: MVQHHLJMCSCIRO-NXMZODBASA-N
SMILES: NC(N/N=C/C1=CC(Br)=C(OCCCCOC2=C(C=C(C=C2Br)/C=N/NC(N)=S)OC)C(OC)=C1)=S
Biological Activity: PARP1-IN-50 is a selective and orally active PARP-1 inhibitor with an IC50 of 64.98 nM. PARP1-IN-50 can inhibit PAR formation and induce DNA double strand breaks, thereby causing DNA damage. PARP1-IN-50 can induce G2/M phase arrest and cancer cells apoptosis. PARP1-IN-50 demonstrates significant antiproliferative activity against various cancer cells. PARP1-IN-50 can be used for the research of cancer, such as breast cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PARP1-IN-50 | PARP1-IN-50 is a selective and orally active PARP-1 inhibitor with an IC50 of 64.98 nM. PARP1-IN-50 can inhibit PAR formation and induce DNA double strand breaks, thereby causing DNA damage. PARP1-IN-50 can induce G2/M phase arrest and cancer cells apoptosis. PARP1-IN-50 demonstrates significant antiproliferative activity against various cancer cells. PARP1-IN-50 can be used for the research of cancer, such as breast cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||