2264091-72-5
Chemical Structure
Azido-PEG12-propargyl
- CAS No.: 2264091-72-5
- Formula:C27H51N3O12
- Molecular Weight:609.71
IUPAC Name: 1-azido-3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxanonatriacont-38-yne
InChIKey: JFQQBUBLJPOZNZ-UHFFFAOYSA-N
SMILES: C#CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG12-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG12-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG12-propargyl | Azido-PEG12-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG12-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
