22768-95-2
Chemical Structure
(-)-Eleutherin
- CAS No.: 22768-95-2
- Formula:C16H16O4
- Molecular Weight:272.30
InChIKey: IAJIIJBMBCZPSW-BDAKNGLRSA-N
SMILES: O=C1C2=C(OC)C=CC=C2C(C3=C1[C@@H](O[C@@H](C3)C)C)=O
Biological Activity: (-)-Eleutherin is a pyranonaphthoquinone derivative that exhibits cytotoxic activity by inhibiting DNA topoisomerase II. (-)-Eleutherin has been shown to have promising potential as a medicinal compound due to its association with naphthoquinones. (-)-Eleutherin demonstrates significant DNA fragmentation rates, indicating its strong cytotoxic effects on cells. Additionally, (-)-Eleutherin possesses higher antioxidant potential compared to control samples, contributing to its therapeutic efficacy.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(-)-Eleutherin | (-)-Eleutherin is a pyranonaphthoquinone derivative that exhibits cytotoxic activity by inhibiting DNA topoisomerase II. (-)-Eleutherin has been shown to have promising potential as a medicinal compound due to its association with naphthoquinones. (-)-Eleutherin demonstrates significant DNA fragmentation rates, indicating its strong cytotoxic effects on cells. Additionally, (-)-Eleutherin possesses higher antioxidant potential compared to control samples, contributing to its therapeutic efficacy. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
